3-Chloropicolinic acid
Catalog No: FT-0645396
CAS No: 57266-69-0
- Chemical Name: 3-Chloropicolinic acid
- Molecular Formula: C6H4ClNO2
- Molecular Weight: 157.55
- InChI Key: XTMUXJBJCMRWPG-UHFFFAOYSA-N
- InChI: InChI=1S/C6H4ClNO2/c7-4-2-1-3-8-5(4)6(9)10/h1-3H,(H,9,10)
| Assay | Pack Size | Price | Stock | Action |
|---|---|---|---|---|
| 98% | 1g | N/A | N/A | |
| 98% | 5g | N/A | N/A | |
| 98% | Bulk Quantity | N/A | N/A |
| Symbol: | Warning |
|---|---|
| FW: | 157.555 |
| Density: | 1.5±0.1 g/cm3 |
| CAS: | 57266-69-0 |
| Bolling_Point: | 297.6±20.0 °C at 760 mmHg |
| Product_Name: | 3-Chloropicolinic acid |
| Melting_Point: | 131ºC (dec.) |
| Flash_Point: | 133.8±21.8 °C |
| MF: | C6H4ClNO2 |
| LogP: | 0.29 |
|---|---|
| Flash_Point: | 133.8±21.8 °C |
| Refractive_Index: | 1.590 |
| FW: | 157.555 |
| Bolling_Point: | 297.6±20.0 °C at 760 mmHg |
| Density: | 1.5±0.1 g/cm3 |
| Melting_Point: | 131ºC (dec.) |
| PSA: | 50.19000 |
| Exact_Mass: | 156.993057 |
| Vapor_Pressure: | 0.0±0.7 mmHg at 25°C |
| MF: | C6H4ClNO2 |
| Personal_Protective_Equipment: | dust mask type N95 (US);Eyeshields;Gloves |
|---|---|
| Hazard_Codes: | Xi:Irritant; |
| Risk_Statements(EU): | R22;R36 |
| Safety_Statements: | S26 |
| Symbol: | Warning |
| Warning_Statement: | P305 + P351 + P338 |
| RIDADR: | NONH for all modes of transport |
| HS_Code: | 2933399090 |
Related Products
3,4-Pyrrolidinediol, 2-[(4-methoxyphenyl)methyl]-, 3-acetate, (2S,3R,4R)-
(4S)-2-[[[(2R)-2-AMino-2-(4-hydroxyphenyl)acetyl]aMino]Methyl]-5,5-diMethyl-4-thiazolidinecarboxylic Acid (Mixture of DiastereoMers)